C8H15N3O5S — CID 153325725
ethyl (3Z)-3-amino-3-[(2-methylsulfonylacetyl)hydrazinylidene]propanoate (PubChem CID 153325725) has the molecular formula C8H15N3O5S and a molecular weight of 265.29 g/mol. Its IUPAC name is ethyl (3Z)-3-amino-3-[(2-methylsulfonylacetyl)hydrazinylidene]propanoate.
| Compound Name | ethyl (3Z)-3-amino-3-[(2-methylsulfonylacetyl)hydrazinylidene]propanoate |
|---|---|
| PubChem CID | 153325725 |
| Molecular Formula | C8H15N3O5S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | ethyl (3Z)-3-amino-3-[(2-methylsulfonylacetyl)hydrazinylidene]propanoate |
| SMILES | CCOC(=O)C/C(N)=N/NC(=O)CS(C)(=O)=O |
| InChI | InChI=1S/C8H15N3O5S/c1-3-16-8(13)4-6(9)10-11-7(12)5-17(2,14)15/h3-5H2,1-2H3,(H2,9,10)(H,11,12) |
| InChIKey | SMQRSFOMWCTVKP-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|