C32H39F3N4O6 — CID 153328274
(2,2,2-trifluoroacetyl) (3R)-3-[3-[[(2R)-2-ethyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]methyl]-4-methylphenyl]-3-[(1-ethyltriazol-4-yl)methoxy]-2,2-dimethylbutaneperoxoate (PubChem CID 153328274) has the molecular formula C32H39F3N4O6 and a molecular weight of 632.68 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) (3R)-3-[3-[[(2R)-2-ethyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]methyl]-4-methylphenyl]-3-[(1-ethyltriazol-4-yl)methoxy]-2,2-dimethylbutaneperoxoate.
| Compound Name | (2,2,2-trifluoroacetyl) (3R)-3-[3-[[(2R)-2-ethyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]methyl]-4-methylphenyl]-3-[(1-ethyltriazol-4-yl)methoxy]-2,2-dimethylbutaneperoxoate |
|---|---|
| PubChem CID | 153328274 |
| Molecular Formula | C32H39F3N4O6 |
| Molecular Weight | 632.68 g/mol |
| Exact Mass | 632.28 |
| IUPAC Name | (2,2,2-trifluoroacetyl) (3R)-3-[3-[[(2R)-2-ethyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]methyl]-4-methylphenyl]-3-[(1-ethyltriazol-4-yl)methoxy]-2,2-dimethylbutaneperoxoate |
| SMILES | CC[C@@H]1CN(Cc2cc([C@@](C)(OCc3cn(CC)nn3)C(C)(C)C(=O)OOC(=O)C(F)(F)F)ccc2C)Cc2ccccc2O1 |
| InChI | InChI=1S/C32H39F3N4O6/c1-7-26-19-38(16-22-11-9-10-12-27(22)43-26)17-23-15-24(14-13-21(23)3)31(6,42-20-25-18-39(8-2)37-36-25)30(4,5)28(40)44-45-29(41)32(33,34)35/h9-15,18,26H,7-8,16-17,19-20H2,1-6H3/t26-,31-/m1/s1 |
| InChIKey | WRCXXKBPXBZQSR-MXBOTTGLSA-N |
| XLogP | 5.80 |
| TPSA | 105.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.68 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|