C26H33F2N4O6P — CID 153333585
propan-2-yl 2-[[[4,4-difluoro-5-[[C-[(Z)-2-formamidoethenyl]-N-methylcarbonimidoyl]amino]oxolan-2-yl]methoxy-naphthalen-1-yloxyphosphanyl]amino]propanoate (PubChem CID 153333585) has the molecular formula C26H33F2N4O6P and a molecular weight of 566.54 g/mol. Its IUPAC name is propan-2-yl 2-[[[4,4-difluoro-5-[[C-[(Z)-2-formamidoethenyl]-N-methylcarbonimidoyl]amino]oxolan-2-yl]methoxy-naphthalen-1-yloxyphosphanyl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[4,4-difluoro-5-[[C-[(Z)-2-formamidoethenyl]-N-methylcarbonimidoyl]amino]oxolan-2-yl]methoxy-naphthalen-1-yloxyphosphanyl]amino]propanoate |
|---|---|
| PubChem CID | 153333585 |
| Molecular Formula | C26H33F2N4O6P |
| Molecular Weight | 566.54 g/mol |
| Exact Mass | 566.21 |
| IUPAC Name | propan-2-yl 2-[[[4,4-difluoro-5-[[C-[(Z)-2-formamidoethenyl]-N-methylcarbonimidoyl]amino]oxolan-2-yl]methoxy-naphthalen-1-yloxyphosphanyl]amino]propanoate |
| SMILES | C/N=C(/C=C\NC=O)NC1OC(COP(NC(C)C(=O)OC(C)C)Oc2cccc3ccccc23)CC1(F)F |
| InChI | InChI=1S/C26H33F2N4O6P/c1-17(2)36-24(34)18(3)32-39(38-22-11-7-9-19-8-5-6-10-21(19)22)35-15-20-14-26(27,28)25(37-20)31-23(29-4)12-13-30-16-33/h5-13,16-18,20,25,32H,14-15H2,1-4H3,(H,29,31)(H,30,33)/b13-12- |
| InChIKey | UGRBVDWMYCTJSI-SEYXRHQNSA-N |
| XLogP | 4.02 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|