C17H38N2 — CID 153342660
ethane;(2E)-3-N-ethyl-2-pentan-2-ylidenebutane-1,3-diimine (PubChem CID 153342660) has the molecular formula C17H38N2 and a molecular weight of 270.50 g/mol. Its IUPAC name is ethane;(2E)-3-N-ethyl-2-pentan-2-ylidenebutane-1,3-diimine.
| Compound Name | ethane;(2E)-3-N-ethyl-2-pentan-2-ylidenebutane-1,3-diimine |
|---|---|
| PubChem CID | 153342660 |
| Molecular Formula | C17H38N2 |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.30 |
| IUPAC Name | ethane;(2E)-3-N-ethyl-2-pentan-2-ylidenebutane-1,3-diimine |
| SMILES | CC.CC.CC.[H]/N=C/C(/C(C)=N/CC)=C(/C)CCC |
| InChI | InChI=1S/C11H20N2.3C2H6/c1-5-7-9(3)11(8-12)10(4)13-6-2;3*1-2/h8,12H,5-7H2,1-4H3;3*1-2H3/b11-9+,12-8+,13-10+;;; |
| InChIKey | MKIGEMJSNSYXGA-OOBOCJHKSA-N |
| XLogP | 6.31 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|