C14H15NO6 — CID 153347142
(2S,4R)-4-(1,3-benzodioxol-5-ylmethyl)pyrrolidine-1,2-dicarboxylic acid (PubChem CID 153347142) has the molecular formula C14H15NO6 and a molecular weight of 293.28 g/mol. Its IUPAC name is (2S,4R)-4-(1,3-benzodioxol-5-ylmethyl)pyrrolidine-1,2-dicarboxylic acid.
| Compound Name | (2S,4R)-4-(1,3-benzodioxol-5-ylmethyl)pyrrolidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 153347142 |
| Molecular Formula | C14H15NO6 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | (2S,4R)-4-(1,3-benzodioxol-5-ylmethyl)pyrrolidine-1,2-dicarboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@@H](Cc2ccc3c(c2)OCO3)CN1C(=O)O |
| InChI | InChI=1S/C14H15NO6/c16-13(17)10-4-9(6-15(10)14(18)19)3-8-1-2-11-12(5-8)21-7-20-11/h1-2,5,9-10H,3-4,6-7H2,(H,16,17)(H,18,19)/t9-,10+/m1/s1 |
| InChIKey | BJCZSBDKPUQIPQ-ZJUUUORDSA-N |
| XLogP | 1.41 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |