C26H38IN6OP — CID 153348473
ethane;5-[4-(1-iodophosphanylpyrazol-4-yl)-2-methoxyphenyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrazin-2-amine (PubChem CID 153348473) has the molecular formula C26H38IN6OP and a molecular weight of 608.51 g/mol. Its IUPAC name is ethane;5-[4-(1-iodophosphanylpyrazol-4-yl)-2-methoxyphenyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrazin-2-amine.
| Compound Name | ethane;5-[4-(1-iodophosphanylpyrazol-4-yl)-2-methoxyphenyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 153348473 |
| Molecular Formula | C26H38IN6OP |
| Molecular Weight | 608.51 g/mol |
| Exact Mass | 608.19 |
| IUPAC Name | ethane;5-[4-(1-iodophosphanylpyrazol-4-yl)-2-methoxyphenyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrazin-2-amine |
| SMILES | CC.COc1cc(-c2cnn(PI)c2)ccc1-c1cnc(N(C)C2CC(C)(C)NC(C)(C)C2)cn1 |
| InChI | InChI=1S/C24H32IN6OP.C2H6/c1-23(2)10-18(11-24(3,4)29-23)30(5)22-14-26-20(13-27-22)19-8-7-16(9-21(19)32-6)17-12-28-31(15-17)33-25;1-2/h7-9,12-15,18,29,33H,10-11H2,1-6H3;1-2H3 |
| InChIKey | DFBGMWMXLFHZHZ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.51 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|