C14H20IN2O2P — CID 153348602
[4-(3,5-dimethoxy-4-methylphenyl)pyrazol-1-yl]-iodophosphane;ethane (PubChem CID 153348602) has the molecular formula C14H20IN2O2P and a molecular weight of 406.20 g/mol. Its IUPAC name is [4-(3,5-dimethoxy-4-methylphenyl)pyrazol-1-yl]-iodophosphane;ethane.
| Compound Name | [4-(3,5-dimethoxy-4-methylphenyl)pyrazol-1-yl]-iodophosphane;ethane |
|---|---|
| PubChem CID | 153348602 |
| Molecular Formula | C14H20IN2O2P |
| Molecular Weight | 406.20 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | [4-(3,5-dimethoxy-4-methylphenyl)pyrazol-1-yl]-iodophosphane;ethane |
| SMILES | CC.COc1cc(-c2cnn(PI)c2)cc(OC)c1C |
| InChI | InChI=1S/C12H14IN2O2P.C2H6/c1-8-11(16-2)4-9(5-12(8)17-3)10-6-14-15(7-10)18-13;1-2/h4-7,18H,1-3H3;1-2H3 |
| InChIKey | RUBMIMBWYDMEMQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.20 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|