C35H42N2O7 — CID 153349089
(2R,3R,4S)-4-(1,3-benzodioxol-5-yl)-1-[[3-(2-ethyl-6-methylanilino)oxiran-2-yl]methyl]-2-[4-(2-propan-2-yloxyethoxy)phenyl]pyrrolidine-3-carboxylic acid (PubChem CID 153349089) has the molecular formula C35H42N2O7 and a molecular weight of 602.73 g/mol. Its IUPAC name is (2R,3R,4S)-4-(1,3-benzodioxol-5-yl)-1-[[3-(2-ethyl-6-methylanilino)oxiran-2-yl]methyl]-2-[4-(2-propan-2-yloxyethoxy)phenyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (2R,3R,4S)-4-(1,3-benzodioxol-5-yl)-1-[[3-(2-ethyl-6-methylanilino)oxiran-2-yl]methyl]-2-[4-(2-propan-2-yloxyethoxy)phenyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 153349089 |
| Molecular Formula | C35H42N2O7 |
| Molecular Weight | 602.73 g/mol |
| Exact Mass | 602.30 |
| IUPAC Name | (2R,3R,4S)-4-(1,3-benzodioxol-5-yl)-1-[[3-(2-ethyl-6-methylanilino)oxiran-2-yl]methyl]-2-[4-(2-propan-2-yloxyethoxy)phenyl]pyrrolidine-3-carboxylic acid |
| SMILES | CCc1cccc(C)c1NC1OC1CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OCCOC(C)C)cc1 |
| InChI | InChI=1S/C35H42N2O7/c1-5-23-8-6-7-22(4)32(23)36-34-30(44-34)19-37-18-27(25-11-14-28-29(17-25)43-20-42-28)31(35(38)39)33(37)24-9-12-26(13-10-24)41-16-15-40-21(2)3/h6-14,17,21,27,30-31,33-34,36H,5,15-16,18-20H2,1-4H3,(H,38,39)/t27-,30?,31-,33+,34?/m1/s1 |
| InChIKey | FSQFZAIPMUWIEN-WHNLJGTHSA-N |
| XLogP | 5.77 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.73 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|