C35H40O7 — CID 158674769
(1R,2R,5S)-5-(1,3-benzodioxol-5-yl)-3-[3-(2,6-dimethylphenyl)-2-oxopropyl]-2-[4-(2-propan-2-yloxyethoxy)phenyl]cyclopentane-1-carboxylic acid (PubChem CID 158674769) has the molecular formula C35H40O7 and a molecular weight of 572.70 g/mol. Its IUPAC name is (1R,2R,5S)-5-(1,3-benzodioxol-5-yl)-3-[3-(2,6-dimethylphenyl)-2-oxopropyl]-2-[4-(2-propan-2-yloxyethoxy)phenyl]cyclopentane-1-carboxylic acid.
| Compound Name | (1R,2R,5S)-5-(1,3-benzodioxol-5-yl)-3-[3-(2,6-dimethylphenyl)-2-oxopropyl]-2-[4-(2-propan-2-yloxyethoxy)phenyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 158674769 |
| Molecular Formula | C35H40O7 |
| Molecular Weight | 572.70 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | (1R,2R,5S)-5-(1,3-benzodioxol-5-yl)-3-[3-(2,6-dimethylphenyl)-2-oxopropyl]-2-[4-(2-propan-2-yloxyethoxy)phenyl]cyclopentane-1-carboxylic acid |
| SMILES | Cc1cccc(C)c1CC(=O)CC1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OCCOC(C)C)cc1 |
| InChI | InChI=1S/C35H40O7/c1-21(2)39-14-15-40-28-11-8-24(9-12-28)33-26(16-27(36)19-29-22(3)6-5-7-23(29)4)17-30(34(33)35(37)38)25-10-13-31-32(18-25)42-20-41-31/h5-13,18,21,26,30,33-34H,14-17,19-20H2,1-4H3,(H,37,38)/t26?,30-,33-,34-/m1/s1 |
| InChIKey | YCEXXXZZXOETNK-NASVZMEGSA-N |
| XLogP | 6.63 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.70 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|