C16H27NO4 — CID 153350348
ethane;ethyl 2-(4-formamido-2-methoxyphenyl)acetate (PubChem CID 153350348) has the molecular formula C16H27NO4 and a molecular weight of 297.40 g/mol. Its IUPAC name is ethane;ethyl 2-(4-formamido-2-methoxyphenyl)acetate.
| Compound Name | ethane;ethyl 2-(4-formamido-2-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 153350348 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | ethane;ethyl 2-(4-formamido-2-methoxyphenyl)acetate |
| SMILES | CC.CC.CCOC(=O)Cc1ccc(NC=O)cc1OC |
| InChI | InChI=1S/C12H15NO4.2C2H6/c1-3-17-12(15)6-9-4-5-10(13-8-14)7-11(9)16-2;2*1-2/h4-5,7-8H,3,6H2,1-2H3,(H,13,14);2*1-2H3 |
| InChIKey | YJDXMWGAMRACHG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|