About CID 153352095
CID 153352095 (PubChem CID 153352095) has the molecular formula C10H10BBrO2
and a molecular weight of 252.90 g/mol.
Molecular Properties
| Compound Name | CID 153352095 |
| PubChem CID | 153352095 |
| Molecular Formula | C10H10BBrO2 |
| Molecular Weight | 252.90 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | — |
| SMILES | [B]Cc1cc(CBr)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C10H10BBrO2/c1-14-10(13)9-3-7(5-11)2-8(4-9)6-12/h2-4H,5-6H2,1H3 |
| InChIKey | IYEBSRUQGNWDBB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.90 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 153352095 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153352095?
The IUPAC name of CID 153352095 (CID 153352095) is not available.
What is the SMILES notation for CID 153352095?
The canonical SMILES for CID 153352095 is [B]Cc1cc(CBr)cc(C(=O)OC)c1.
What is the InChIKey of CID 153352095?
The InChIKey is IYEBSRUQGNWDBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BBrO2/c1-14-10(13)9-3-7(5-11)2-8(4-9)6-12/h2-4H,5-6H2,1H3.
What are the key properties of CID 153352095?
CID 153352095 has a molecular weight of 252.90 g/mol, XLogP of 2.04, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153352095 is sourced from PubChem (CID 153352095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).