About CID 87414098
CID 87414098 (PubChem CID 87414098) has the molecular formula C10H12BBr
and a molecular weight of 222.92 g/mol.
Molecular Properties
| Compound Name | CID 87414098 |
| PubChem CID | 87414098 |
| Molecular Formula | C10H12BBr |
| Molecular Weight | 222.92 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | — |
| SMILES | [B]Cc1cc(CC)cc(CBr)c1 |
| InChI | InChI=1S/C10H12BBr/c1-2-8-3-9(6-11)5-10(4-8)7-12/h3-5H,2,6-7H2,1H3 |
| InChIKey | STQCMAHFCBLPMO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.92 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87414098 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87414098?
The IUPAC name of CID 87414098 (CID 87414098) is not available.
What is the SMILES notation for CID 87414098?
The canonical SMILES for CID 87414098 is [B]Cc1cc(CC)cc(CBr)c1.
What is the InChIKey of CID 87414098?
The InChIKey is STQCMAHFCBLPMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BBr/c1-2-8-3-9(6-11)5-10(4-8)7-12/h3-5H,2,6-7H2,1H3.
What are the key properties of CID 87414098?
CID 87414098 has a molecular weight of 222.92 g/mol, XLogP of 2.81, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87414098 is sourced from PubChem (CID 87414098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).