C19H34 — CID 159585163
3-ethylpentane;1,3,5-triethylbenzene (PubChem CID 159585163) has the molecular formula C19H34 and a molecular weight of 262.48 g/mol. Its IUPAC name is 3-ethylpentane;1,3,5-triethylbenzene.
| Compound Name | 3-ethylpentane;1,3,5-triethylbenzene |
|---|---|
| PubChem CID | 159585163 |
| Molecular Formula | C19H34 |
| Molecular Weight | 262.48 g/mol |
| Exact Mass | 262.27 |
| IUPAC Name | 3-ethylpentane;1,3,5-triethylbenzene |
| SMILES | CCC(CC)CC.CCc1cc(CC)cc(CC)c1 |
| InChI | InChI=1S/C12H18.C7H16/c1-4-10-7-11(5-2)9-12(6-3)8-10;1-4-7(5-2)6-3/h7-9H,4-6H2,1-3H3;7H,4-6H2,1-3H3 |
| InChIKey | MJNGGTOWXBUTAD-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.48 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |