C10H15P — CID 20818145
(3,5-diethylphenyl)phosphane (PubChem CID 20818145) has the molecular formula C10H15P and a molecular weight of 166.20 g/mol. Its IUPAC name is (3,5-diethylphenyl)phosphane.
| Compound Name | (3,5-diethylphenyl)phosphane |
|---|---|
| PubChem CID | 20818145 |
| Molecular Formula | C10H15P |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | (3,5-diethylphenyl)phosphane |
| SMILES | CCc1cc(P)cc(CC)c1 |
| InChI | InChI=1S/C10H15P/c1-3-8-5-9(4-2)7-10(11)6-8/h5-7H,3-4,11H2,1-2H3 |
| InChIKey | FIUDMFBZPMKQBI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|