C17H32O — CID 153352210
(Z)-9-ethyl-3,7-dimethyltridec-6-enal (PubChem CID 153352210) has the molecular formula C17H32O and a molecular weight of 252.44 g/mol. Its IUPAC name is (Z)-9-ethyl-3,7-dimethyltridec-6-enal.
| Compound Name | (Z)-9-ethyl-3,7-dimethyltridec-6-enal |
|---|---|
| PubChem CID | 153352210 |
| Molecular Formula | C17H32O |
| Molecular Weight | 252.44 g/mol |
| Exact Mass | 252.25 |
| IUPAC Name | (Z)-9-ethyl-3,7-dimethyltridec-6-enal |
| SMILES | CCCCC(CC)C/C(C)=C\CCC(C)CC=O |
| InChI | InChI=1S/C17H32O/c1-5-7-11-17(6-2)14-16(4)10-8-9-15(3)12-13-18/h10,13,15,17H,5-9,11-12,14H2,1-4H3/b16-10- |
| InChIKey | YHPLXUMUSUSVAY-YBEGLDIGSA-N |
| XLogP | 5.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.44 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|