C23H26N4O3S — CID 153352327
4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]sulfanyl-N-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]benzamide (PubChem CID 153352327) has the molecular formula C23H26N4O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is 4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]sulfanyl-N-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]benzamide.
| Compound Name | 4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]sulfanyl-N-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 153352327 |
| Molecular Formula | C23H26N4O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]sulfanyl-N-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]benzamide |
| SMILES | COc1ccc(-c2nnc(NC(=O)c3ccc(SN4C[C@H](C)C[C@H](C)C4)cc3)o2)cc1 |
| InChI | InChI=1S/C23H26N4O3S/c1-15-12-16(2)14-27(13-15)31-20-10-6-17(7-11-20)21(28)24-23-26-25-22(30-23)18-4-8-19(29-3)9-5-18/h4-11,15-16H,12-14H2,1-3H3,(H,24,26,28)/t15-,16+ |
| InChIKey | WBISESRHUKLYQT-IYBDPMFKSA-N |
| XLogP | 4.98 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|