C14H14F3N3O2S2 — CID 153354566
N-methoxy-N-[1-[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]ethyl]cyclopropanecarbothioamide (PubChem CID 153354566) has the molecular formula C14H14F3N3O2S2 and a molecular weight of 377.41 g/mol. Its IUPAC name is N-methoxy-N-[1-[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]ethyl]cyclopropanecarbothioamide.
| Compound Name | N-methoxy-N-[1-[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]ethyl]cyclopropanecarbothioamide |
|---|---|
| PubChem CID | 153354566 |
| Molecular Formula | C14H14F3N3O2S2 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | N-methoxy-N-[1-[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]ethyl]cyclopropanecarbothioamide |
| SMILES | CON(C(=S)C1CC1)C(C)c1ccc(-c2noc(C(F)(F)F)n2)s1 |
| InChI | InChI=1S/C14H14F3N3O2S2/c1-7(20(21-2)12(23)8-3-4-8)9-5-6-10(24-9)11-18-13(22-19-11)14(15,16)17/h5-8H,3-4H2,1-2H3 |
| InChIKey | INMAKIJWKMRKQI-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|