C54H46N6 — CID 153354933
3-[3-[3-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]phenyl]-5,6-bis(ethenyl)pyrazin-2-yl]benzonitrile;(3Z,5Z)-hepta-1,3,5-triene;2-methylpropanenitrile (PubChem CID 153354933) has the molecular formula C54H46N6 and a molecular weight of 779.00 g/mol. Its IUPAC name is 3-[3-[3-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]phenyl]-5,6-bis(ethenyl)pyrazin-2-yl]benzonitrile;(3Z,5Z)-hepta-1,3,5-triene;2-methylpropanenitrile.
| Compound Name | 3-[3-[3-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]phenyl]-5,6-bis(ethenyl)pyrazin-2-yl]benzonitrile;(3Z,5Z)-hepta-1,3,5-triene;2-methylpropanenitrile |
|---|---|
| PubChem CID | 153354933 |
| Molecular Formula | C54H46N6 |
| Molecular Weight | 779.00 g/mol |
| Exact Mass | 778.38 |
| IUPAC Name | 3-[3-[3-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]phenyl]-5,6-bis(ethenyl)pyrazin-2-yl]benzonitrile;(3Z,5Z)-hepta-1,3,5-triene;2-methylpropanenitrile |
| SMILES | C=C/C=C\C=C/C.C=Cc1nc(-c2cccc(C#N)c2)c(-c2cccc(-c3cccc(-c4nc(-c5ccccc5)cc(-c5ccccc5)n4)c3)c2)nc1C=C.CC(C)C#N |
| InChI | InChI=1S/C43H29N5.C7H10.C4H7N/c1-3-37-38(4-2)46-42(41(45-37)34-21-11-14-29(24-34)28-44)35-22-12-19-32(25-35)33-20-13-23-36(26-33)43-47-39(30-15-7-5-8-16-30)27-40(48-43)31-17-9-6-10-18-31;1-3-5-7-6-4-2;1-4(2)3-5/h3-27H,1-2H2;3-7H,1H2,2H3;4H,1-2H3/b;6-4-,7-5-; |
| InChIKey | QUFFCSHMNFTDNR-SBMQUTPRSA-N |
| XLogP | 13.90 |
| TPSA | 99.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.00 |
| LogP ≤ 5 | 13.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|