C16H13BrF2N2O2S — CID 153360284
5-bromo-2-[(4-ethylsulfonylphenyl)methyl]-4,6-difluoro-1H-benzimidazole (PubChem CID 153360284) has the molecular formula C16H13BrF2N2O2S and a molecular weight of 415.26 g/mol. Its IUPAC name is 5-bromo-2-[(4-ethylsulfonylphenyl)methyl]-4,6-difluoro-1H-benzimidazole.
| Compound Name | 5-bromo-2-[(4-ethylsulfonylphenyl)methyl]-4,6-difluoro-1H-benzimidazole |
|---|---|
| PubChem CID | 153360284 |
| Molecular Formula | C16H13BrF2N2O2S |
| Molecular Weight | 415.26 g/mol |
| Exact Mass | 413.98 |
| IUPAC Name | 5-bromo-2-[(4-ethylsulfonylphenyl)methyl]-4,6-difluoro-1H-benzimidazole |
| SMILES | CCS(=O)(=O)c1ccc(Cc2nc3c(F)c(Br)c(F)cc3[nH]2)cc1 |
| InChI | InChI=1S/C16H13BrF2N2O2S/c1-2-24(22,23)10-5-3-9(4-6-10)7-13-20-12-8-11(18)14(17)15(19)16(12)21-13/h3-6,8H,2,7H2,1H3,(H,20,21) |
| InChIKey | JMGCEIYKINGCRX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.26 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|