C15H13ClN2O2S — CID 13403147
2-benzyl-6-(chloromethylsulfonyl)-1H-benzimidazole (PubChem CID 13403147) has the molecular formula C15H13ClN2O2S and a molecular weight of 320.80 g/mol. Its IUPAC name is 2-benzyl-6-(chloromethylsulfonyl)-1H-benzimidazole.
| Compound Name | 2-benzyl-6-(chloromethylsulfonyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 13403147 |
| Molecular Formula | C15H13ClN2O2S |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 2-benzyl-6-(chloromethylsulfonyl)-1H-benzimidazole |
| SMILES | O=S(=O)(CCl)c1ccc2nc(Cc3ccccc3)[nH]c2c1 |
| InChI | InChI=1S/C15H13ClN2O2S/c16-10-21(19,20)12-6-7-13-14(9-12)18-15(17-13)8-11-4-2-1-3-5-11/h1-7,9H,8,10H2,(H,17,18) |
| InChIKey | IMKJLLWADHNBBT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|