C10H5F5N2O — CID 170588292
4,6-difluoro-2-(2,2,2-trifluoroethyl)-1H-benzimidazole-5-carbaldehyde (PubChem CID 170588292) has the molecular formula C10H5F5N2O and a molecular weight of 264.15 g/mol. Its IUPAC name is 4,6-difluoro-2-(2,2,2-trifluoroethyl)-1H-benzimidazole-5-carbaldehyde.
| Compound Name | 4,6-difluoro-2-(2,2,2-trifluoroethyl)-1H-benzimidazole-5-carbaldehyde |
|---|---|
| PubChem CID | 170588292 |
| Molecular Formula | C10H5F5N2O |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 4,6-difluoro-2-(2,2,2-trifluoroethyl)-1H-benzimidazole-5-carbaldehyde |
| SMILES | O=Cc1c(F)cc2[nH]c(CC(F)(F)F)nc2c1F |
| InChI | InChI=1S/C10H5F5N2O/c11-5-1-6-9(8(12)4(5)3-18)17-7(16-6)2-10(13,14)15/h1,3H,2H2,(H,16,17) |
| InChIKey | WHDBTDPBBOQGNF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|