C20H36N4O4Si — CID 153361698
tert-butyl 6-[tert-butyl(dimethyl)silyl]oxy-4-(5-hydroxypyrimidin-2-yl)-1,4-diazepane-1-carboxylate (PubChem CID 153361698) has the molecular formula C20H36N4O4Si and a molecular weight of 424.62 g/mol. Its IUPAC name is tert-butyl 6-[tert-butyl(dimethyl)silyl]oxy-4-(5-hydroxypyrimidin-2-yl)-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 6-[tert-butyl(dimethyl)silyl]oxy-4-(5-hydroxypyrimidin-2-yl)-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 153361698 |
| Molecular Formula | C20H36N4O4Si |
| Molecular Weight | 424.62 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | tert-butyl 6-[tert-butyl(dimethyl)silyl]oxy-4-(5-hydroxypyrimidin-2-yl)-1,4-diazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ncc(O)cn2)CC(O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C20H36N4O4Si/c1-19(2,3)27-18(26)24-10-9-23(17-21-11-15(25)12-22-17)13-16(14-24)28-29(7,8)20(4,5)6/h11-12,16,25H,9-10,13-14H2,1-8H3 |
| InChIKey | JATDOHSFEQLYTE-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.62 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|