C16H23N3O3 — CID 153362210
ethyl 3-[(3R)-4-(5-formyl-2-pyridinyl)-3-methylpiperazin-1-yl]propanoate (PubChem CID 153362210) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is ethyl 3-[(3R)-4-(5-formyl-2-pyridinyl)-3-methylpiperazin-1-yl]propanoate.
| Compound Name | ethyl 3-[(3R)-4-(5-formyl-2-pyridinyl)-3-methylpiperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 153362210 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | ethyl 3-[(3R)-4-(5-formyl-2-pyridinyl)-3-methylpiperazin-1-yl]propanoate |
| SMILES | CCOC(=O)CCN1CCN(c2ccc(C=O)cn2)[C@H](C)C1 |
| InChI | InChI=1S/C16H23N3O3/c1-3-22-16(21)6-7-18-8-9-19(13(2)11-18)15-5-4-14(12-20)10-17-15/h4-5,10,12-13H,3,6-9,11H2,1-2H3/t13-/m1/s1 |
| InChIKey | RQHNZCIPDTVUHE-CYBMUJFWSA-N |
| XLogP | 1.36 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|