C11H11BrN2O3 — CID 153363306
2-bromo-1-(4,6-dimethoxypyrazolo[1,5-a]pyridin-2-yl)ethanone (PubChem CID 153363306) has the molecular formula C11H11BrN2O3 and a molecular weight of 299.12 g/mol. Its IUPAC name is 2-bromo-1-(4,6-dimethoxypyrazolo[1,5-a]pyridin-2-yl)ethanone.
| Compound Name | 2-bromo-1-(4,6-dimethoxypyrazolo[1,5-a]pyridin-2-yl)ethanone |
|---|---|
| PubChem CID | 153363306 |
| Molecular Formula | C11H11BrN2O3 |
| Molecular Weight | 299.12 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | 2-bromo-1-(4,6-dimethoxypyrazolo[1,5-a]pyridin-2-yl)ethanone |
| SMILES | COc1cc(OC)c2cc(C(=O)CBr)nn2c1 |
| InChI | InChI=1S/C11H11BrN2O3/c1-16-7-3-11(17-2)9-4-8(10(15)5-12)13-14(9)6-7/h3-4,6H,5H2,1-2H3 |
| InChIKey | BMWMIYUWQKBECP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.12 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|