C31H41ClN2O3S — CID 153364309
3-[3-(3-chlorophenyl)propyl]-5-[[(1R,2R)-2-[(E,1S)-1-methoxy-6-sulfanylhex-2-enyl]cyclobutyl]methyl]-3,4-dihydro-2H-1,5-benzoxazepine-7-carboxamide (PubChem CID 153364309) has the molecular formula C31H41ClN2O3S and a molecular weight of 557.20 g/mol. Its IUPAC name is 3-[3-(3-chlorophenyl)propyl]-5-[[(1R,2R)-2-[(E,1S)-1-methoxy-6-sulfanylhex-2-enyl]cyclobutyl]methyl]-3,4-dihydro-2H-1,5-benzoxazepine-7-carboxamide.
| Compound Name | 3-[3-(3-chlorophenyl)propyl]-5-[[(1R,2R)-2-[(E,1S)-1-methoxy-6-sulfanylhex-2-enyl]cyclobutyl]methyl]-3,4-dihydro-2H-1,5-benzoxazepine-7-carboxamide |
|---|---|
| PubChem CID | 153364309 |
| Molecular Formula | C31H41ClN2O3S |
| Molecular Weight | 557.20 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | 3-[3-(3-chlorophenyl)propyl]-5-[[(1R,2R)-2-[(E,1S)-1-methoxy-6-sulfanylhex-2-enyl]cyclobutyl]methyl]-3,4-dihydro-2H-1,5-benzoxazepine-7-carboxamide |
| SMILES | CO[C@@H](/C=C/CCCS)[C@@H]1CC[C@H]1CN1CC(CCCc2cccc(Cl)c2)COc2ccc(C(N)=O)cc21 |
| InChI | InChI=1S/C31H41ClN2O3S/c1-36-29(11-3-2-4-16-38)27-14-12-25(27)20-34-19-23(9-5-7-22-8-6-10-26(32)17-22)21-37-30-15-13-24(31(33)35)18-28(30)34/h3,6,8,10-11,13,15,17-18,23,25,27,29,38H,2,4-5,7,9,12,14,16,19-21H2,1H3,(H2,33,35)/b11-3+/t23?,25-,27+,29-/m0/s1 |
| InChIKey | RHVRGAJYFUWVOT-FMRHZVQOSA-N |
| XLogP | 6.58 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.20 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|