C33H49ClN2O4S3 — CID 156740576
CID 156740576 (PubChem CID 156740576) has the molecular formula C33H49ClN2O4S3 and a molecular weight of 669.42 g/mol.
| Compound Name | CID 156740576 |
|---|---|
| PubChem CID | 156740576 |
| Molecular Formula | C33H49ClN2O4S3 |
| Molecular Weight | 669.42 g/mol |
| Exact Mass | 668.25 |
| IUPAC Name | — |
| SMILES | CC[C@@H](CN1CC(CCCc2cccc(Cl)c2)COc2ccc(C(N)=O)cc21)CC(O)(/C=C/C[C@H](C)CS)CCO.SS |
| InChI | InChI=1S/C33H47ClN2O4S.H2S2/c1-3-25(19-33(39,15-16-37)14-6-7-24(2)23-41)20-36-21-27(10-4-8-26-9-5-11-29(34)17-26)22-40-31-13-12-28(32(35)38)18-30(31)36;1-2/h5-6,9,11-14,17-18,24-25,27,37,39,41H,3-4,7-8,10,15-16,19-23H2,1-2H3,(H2,35,38);1-2H/b14-6+;/t24-,25+,27?,33?;/m0./s1 |
| InChIKey | HDKNROMSXCRWNY-SDAFHICMSA-N |
| XLogP | 7.08 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.42 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|