C31H41ClN2O3S — CID 156740585
3-[3-(3-chlorophenyl)propyl]-5-[(E,3R,8S)-3-ethyl-8-methyl-4-oxo-9-sulfanylnon-5-enyl]-3,4-dihydro-2H-1,5-benzoxazepine-7-carboxamide (PubChem CID 156740585) has the molecular formula C31H41ClN2O3S and a molecular weight of 557.20 g/mol. Its IUPAC name is 3-[3-(3-chlorophenyl)propyl]-5-[(E,3R,8S)-3-ethyl-8-methyl-4-oxo-9-sulfanylnon-5-enyl]-3,4-dihydro-2H-1,5-benzoxazepine-7-carboxamide.
| Compound Name | 3-[3-(3-chlorophenyl)propyl]-5-[(E,3R,8S)-3-ethyl-8-methyl-4-oxo-9-sulfanylnon-5-enyl]-3,4-dihydro-2H-1,5-benzoxazepine-7-carboxamide |
|---|---|
| PubChem CID | 156740585 |
| Molecular Formula | C31H41ClN2O3S |
| Molecular Weight | 557.20 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | 3-[3-(3-chlorophenyl)propyl]-5-[(E,3R,8S)-3-ethyl-8-methyl-4-oxo-9-sulfanylnon-5-enyl]-3,4-dihydro-2H-1,5-benzoxazepine-7-carboxamide |
| SMILES | CC[C@H](CCN1CC(CCCc2cccc(Cl)c2)COc2ccc(C(N)=O)cc21)C(=O)/C=C/C[C@H](C)CS |
| InChI | InChI=1S/C31H41ClN2O3S/c1-3-25(29(35)12-4-7-22(2)21-38)15-16-34-19-24(10-5-8-23-9-6-11-27(32)17-23)20-37-30-14-13-26(31(33)36)18-28(30)34/h4,6,9,11-14,17-18,22,24-25,38H,3,5,7-8,10,15-16,19-21H2,1-2H3,(H2,33,36)/b12-4+/t22-,24?,25+/m0/s1 |
| InChIKey | NXUGJUQUEIEWFO-LZLKTBIRSA-N |
| XLogP | 6.77 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.20 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|