C27H34ClNO3 — CID 163368915
3-[3-(3-chlorophenyl)propyl]-5-(2-ethylhex-5-enyl)-3,4-dihydro-2H-1,5-benzoxazepine-7-carboxylic acid (PubChem CID 163368915) has the molecular formula C27H34ClNO3 and a molecular weight of 456.03 g/mol. Its IUPAC name is 3-[3-(3-chlorophenyl)propyl]-5-(2-ethylhex-5-enyl)-3,4-dihydro-2H-1,5-benzoxazepine-7-carboxylic acid.
| Compound Name | 3-[3-(3-chlorophenyl)propyl]-5-(2-ethylhex-5-enyl)-3,4-dihydro-2H-1,5-benzoxazepine-7-carboxylic acid |
|---|---|
| PubChem CID | 163368915 |
| Molecular Formula | C27H34ClNO3 |
| Molecular Weight | 456.03 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 3-[3-(3-chlorophenyl)propyl]-5-(2-ethylhex-5-enyl)-3,4-dihydro-2H-1,5-benzoxazepine-7-carboxylic acid |
| SMILES | C=CCCC(CC)CN1CC(CCCc2cccc(Cl)c2)COc2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C27H34ClNO3/c1-3-5-8-20(4-2)17-29-18-22(11-6-9-21-10-7-12-24(28)15-21)19-32-26-14-13-23(27(30)31)16-25(26)29/h3,7,10,12-16,20,22H,1,4-6,8-9,11,17-19H2,2H3,(H,30,31) |
| InChIKey | VEFCNXOTNMHGCT-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.03 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|