About 1-ethyl-5,6-difluoro-2,3-dihydro-1H-isoindole;hydrochloride
1-ethyl-5,6-difluoro-2,3-dihydro-1H-isoindole;hydrochloride (PubChem CID 153364867) has the molecular formula C10H12ClF2N
and a molecular weight of 219.66 g/mol. Its IUPAC name is 1-ethyl-5,6-difluoro-2,3-dihydro-1H-isoindole;hydrochloride.
Molecular Properties
| Compound Name | 1-ethyl-5,6-difluoro-2,3-dihydro-1H-isoindole;hydrochloride |
| PubChem CID | 153364867 |
| Molecular Formula | C10H12ClF2N |
| Molecular Weight | 219.66 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 1-ethyl-5,6-difluoro-2,3-dihydro-1H-isoindole;hydrochloride |
| SMILES | CCC1NCc2cc(F)c(F)cc21.Cl |
| InChI | InChI=1S/C10H11F2N.ClH/c1-2-10-7-4-9(12)8(11)3-6(7)5-13-10;/h3-4,10,13H,2,5H2,1H3;1H |
| InChIKey | QOPRZLBVGANNFI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.66 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethyl-5,6-difluoro-2,3-dihydro-1H-isoindole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-5,6-difluoro-2,3-dihydro-1H-isoindole;hydrochloride?
The IUPAC name of 1-ethyl-5,6-difluoro-2,3-dihydro-1H-isoindole;hydrochloride (CID 153364867) is 1-ethyl-5,6-difluoro-2,3-dihydro-1H-isoindole;hydrochloride.
What is the SMILES notation for 1-ethyl-5,6-difluoro-2,3-dihydro-1H-isoindole;hydrochloride?
The canonical SMILES for 1-ethyl-5,6-difluoro-2,3-dihydro-1H-isoindole;hydrochloride is CCC1NCc2cc(F)c(F)cc21.Cl.
What is the InChIKey of 1-ethyl-5,6-difluoro-2,3-dihydro-1H-isoindole;hydrochloride?
The InChIKey is QOPRZLBVGANNFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F2N.ClH/c1-2-10-7-4-9(12)8(11)3-6(7)5-13-10;/h3-4,10,13H,2,5H2,1H3;1H.
What are the key properties of 1-ethyl-5,6-difluoro-2,3-dihydro-1H-isoindole;hydrochloride?
1-ethyl-5,6-difluoro-2,3-dihydro-1H-isoindole;hydrochloride has a molecular weight of 219.66 g/mol, XLogP of 2.94, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-5,6-difluoro-2,3-dihydro-1H-isoindole;hydrochloride is sourced from PubChem (CID 153364867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).