C12H24O5 — CID 153365064
5-methoxy-6-prop-2-enyloxan-2-ol;propane-2,2-diol (PubChem CID 153365064) has the molecular formula C12H24O5 and a molecular weight of 248.32 g/mol. Its IUPAC name is 5-methoxy-6-prop-2-enyloxan-2-ol;propane-2,2-diol.
| Compound Name | 5-methoxy-6-prop-2-enyloxan-2-ol;propane-2,2-diol |
|---|---|
| PubChem CID | 153365064 |
| Molecular Formula | C12H24O5 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 5-methoxy-6-prop-2-enyloxan-2-ol;propane-2,2-diol |
| SMILES | C=CCC1OC(O)CCC1OC.CC(C)(O)O |
| InChI | InChI=1S/C9H16O3.C3H8O2/c1-3-4-8-7(11-2)5-6-9(10)12-8;1-3(2,4)5/h3,7-10H,1,4-6H2,2H3;4-5H,1-2H3 |
| InChIKey | XWLWUDXSDWENNH-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|