C6H10O2 — CID 86339358
(2S,5S)-5-ethenyloxolan-2-ol (PubChem CID 86339358) has the molecular formula C6H10O2 and a molecular weight of 114.14 g/mol. Its IUPAC name is (2S,5S)-5-ethenyloxolan-2-ol.
| Compound Name | (2S,5S)-5-ethenyloxolan-2-ol |
|---|---|
| PubChem CID | 86339358 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | (2S,5S)-5-ethenyloxolan-2-ol |
| SMILES | C=C[C@@H]1CC[C@@H](O)O1 |
| InChI | InChI=1S/C6H10O2/c1-2-5-3-4-6(7)8-5/h2,5-7H,1,3-4H2/t5-,6+/m1/s1 |
| InChIKey | UDJUNCFCZYQSAU-RITPCOANSA-N |
| XLogP | 0.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|