C8H12O2 — CID 12949552
5-[(1E)-buta-1,3-dienyl]oxolan-2-ol (PubChem CID 12949552) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is 5-[(1E)-buta-1,3-dienyl]oxolan-2-ol.
| Compound Name | 5-[(1E)-buta-1,3-dienyl]oxolan-2-ol |
|---|---|
| PubChem CID | 12949552 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 5-[(1E)-buta-1,3-dienyl]oxolan-2-ol |
| SMILES | C=C/C=C/C1CCC(O)O1 |
| InChI | InChI=1S/C8H12O2/c1-2-3-4-7-5-6-8(9)10-7/h2-4,7-9H,1,5-6H2/b4-3+ |
| InChIKey | WHDDGGPEMCSWLT-ONEGZZNKSA-N |
| XLogP | 1.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|