C9H14O2 — CID 139588226
(2R,3R,5R)-2-[(1E)-buta-1,3-dienyl]-5-methyloxolan-3-ol (PubChem CID 139588226) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is (2R,3R,5R)-2-[(1E)-buta-1,3-dienyl]-5-methyloxolan-3-ol.
| Compound Name | (2R,3R,5R)-2-[(1E)-buta-1,3-dienyl]-5-methyloxolan-3-ol |
|---|---|
| PubChem CID | 139588226 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | (2R,3R,5R)-2-[(1E)-buta-1,3-dienyl]-5-methyloxolan-3-ol |
| SMILES | C=C/C=C/[C@H]1O[C@H](C)C[C@H]1O |
| InChI | InChI=1S/C9H14O2/c1-3-4-5-9-8(10)6-7(2)11-9/h3-5,7-10H,1,6H2,2H3/b5-4+/t7-,8-,9-/m1/s1 |
| InChIKey | GUXAFFOQBHDGJZ-VARVQHAUSA-N |
| XLogP | 1.27 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|