C8H10O — CID 123446892
2-buta-1,3-dienyl-3-ethenyloxirane (PubChem CID 123446892) has the molecular formula C8H10O and a molecular weight of 122.17 g/mol. Its IUPAC name is 2-buta-1,3-dienyl-3-ethenyloxirane.
| Compound Name | 2-buta-1,3-dienyl-3-ethenyloxirane |
|---|---|
| PubChem CID | 123446892 |
| Molecular Formula | C8H10O |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | 2-buta-1,3-dienyl-3-ethenyloxirane |
| SMILES | C=CC=CC1OC1C=C |
| InChI | InChI=1S/C8H10O/c1-3-5-6-8-7(4-2)9-8/h3-8H,1-2H2 |
| InChIKey | ZVSBPLCOISZJGR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|