C23H24ClFN4O5 — CID 153365923
N-[1-(4-chloro-3-hydroxyphenyl)-3-oxopropan-2-yl]-2-(dimethylamino)-3-(5-fluoro-4-nitro-1H-indol-3-yl)-N-methylpropanamide (PubChem CID 153365923) has the molecular formula C23H24ClFN4O5 and a molecular weight of 490.92 g/mol. Its IUPAC name is N-[1-(4-chloro-3-hydroxyphenyl)-3-oxopropan-2-yl]-2-(dimethylamino)-3-(5-fluoro-4-nitro-1H-indol-3-yl)-N-methylpropanamide.
| Compound Name | N-[1-(4-chloro-3-hydroxyphenyl)-3-oxopropan-2-yl]-2-(dimethylamino)-3-(5-fluoro-4-nitro-1H-indol-3-yl)-N-methylpropanamide |
|---|---|
| PubChem CID | 153365923 |
| Molecular Formula | C23H24ClFN4O5 |
| Molecular Weight | 490.92 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | N-[1-(4-chloro-3-hydroxyphenyl)-3-oxopropan-2-yl]-2-(dimethylamino)-3-(5-fluoro-4-nitro-1H-indol-3-yl)-N-methylpropanamide |
| SMILES | CN(C)C(Cc1c[nH]c2ccc(F)c([N+](=O)[O-])c12)C(=O)N(C)C(C=O)Cc1ccc(Cl)c(O)c1 |
| InChI | InChI=1S/C23H24ClFN4O5/c1-27(2)19(10-14-11-26-18-7-6-17(25)22(21(14)18)29(33)34)23(32)28(3)15(12-30)8-13-4-5-16(24)20(31)9-13/h4-7,9,11-12,15,19,26,31H,8,10H2,1-3H3 |
| InChIKey | OFTGVJUDWBVSCP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 119.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.92 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|