C22H20F2N4O6 — CID 158274853
(3R,6S)-3-[(2-fluoro-3-hydroxyphenyl)methyl]-6-[(5-fluoro-4-nitro-1H-indol-3-yl)methyl]-3-hydroxy-1,4-dimethylpiperazine-2,5-dione (PubChem CID 158274853) has the molecular formula C22H20F2N4O6 and a molecular weight of 474.42 g/mol. Its IUPAC name is (3R,6S)-3-[(2-fluoro-3-hydroxyphenyl)methyl]-6-[(5-fluoro-4-nitro-1H-indol-3-yl)methyl]-3-hydroxy-1,4-dimethylpiperazine-2,5-dione.
| Compound Name | (3R,6S)-3-[(2-fluoro-3-hydroxyphenyl)methyl]-6-[(5-fluoro-4-nitro-1H-indol-3-yl)methyl]-3-hydroxy-1,4-dimethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 158274853 |
| Molecular Formula | C22H20F2N4O6 |
| Molecular Weight | 474.42 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | (3R,6S)-3-[(2-fluoro-3-hydroxyphenyl)methyl]-6-[(5-fluoro-4-nitro-1H-indol-3-yl)methyl]-3-hydroxy-1,4-dimethylpiperazine-2,5-dione |
| SMILES | CN1C(=O)[C@](O)(Cc2cccc(O)c2F)N(C)C(=O)[C@@H]1Cc1c[nH]c2ccc(F)c([N+](=O)[O-])c12 |
| InChI | InChI=1S/C22H20F2N4O6/c1-26-15(8-12-10-25-14-7-6-13(23)19(17(12)14)28(33)34)20(30)27(2)22(32,21(26)31)9-11-4-3-5-16(29)18(11)24/h3-7,10,15,25,29,32H,8-9H2,1-2H3/t15-,22+/m0/s1 |
| InChIKey | IXCBOCSRIOCEEQ-OYHNWAKOSA-N |
| XLogP | 1.83 |
| TPSA | 140.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|