C23H24ClFN4O4 — CID 153365992
N-[1-(3-chlorophenyl)-3-oxopropan-2-yl]-2-(dimethylamino)-3-(5-fluoro-4-nitro-1H-indol-3-yl)-N-methylpropanamide (PubChem CID 153365992) has the molecular formula C23H24ClFN4O4 and a molecular weight of 474.92 g/mol. Its IUPAC name is N-[1-(3-chlorophenyl)-3-oxopropan-2-yl]-2-(dimethylamino)-3-(5-fluoro-4-nitro-1H-indol-3-yl)-N-methylpropanamide.
| Compound Name | N-[1-(3-chlorophenyl)-3-oxopropan-2-yl]-2-(dimethylamino)-3-(5-fluoro-4-nitro-1H-indol-3-yl)-N-methylpropanamide |
|---|---|
| PubChem CID | 153365992 |
| Molecular Formula | C23H24ClFN4O4 |
| Molecular Weight | 474.92 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | N-[1-(3-chlorophenyl)-3-oxopropan-2-yl]-2-(dimethylamino)-3-(5-fluoro-4-nitro-1H-indol-3-yl)-N-methylpropanamide |
| SMILES | CN(C)C(Cc1c[nH]c2ccc(F)c([N+](=O)[O-])c12)C(=O)N(C)C(C=O)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H24ClFN4O4/c1-27(2)20(11-15-12-26-19-8-7-18(25)22(21(15)19)29(32)33)23(31)28(3)17(13-30)10-14-5-4-6-16(24)9-14/h4-9,12-13,17,20,26H,10-11H2,1-3H3 |
| InChIKey | ZQLSHLRNHWDZNV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 99.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.92 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|