C10H18FN3S — CID 153366867
(E)-3-[(3S,4S)-3-fluoro-4-methylpiperidin-1-yl]-3-imino-1-methylsulfanylprop-1-en-1-amine (PubChem CID 153366867) has the molecular formula C10H18FN3S and a molecular weight of 231.34 g/mol. Its IUPAC name is (E)-3-[(3S,4S)-3-fluoro-4-methylpiperidin-1-yl]-3-imino-1-methylsulfanylprop-1-en-1-amine.
| Compound Name | (E)-3-[(3S,4S)-3-fluoro-4-methylpiperidin-1-yl]-3-imino-1-methylsulfanylprop-1-en-1-amine |
|---|---|
| PubChem CID | 153366867 |
| Molecular Formula | C10H18FN3S |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | (E)-3-[(3S,4S)-3-fluoro-4-methylpiperidin-1-yl]-3-imino-1-methylsulfanylprop-1-en-1-amine |
| SMILES | [H]/N=C(\C=C(/N)SC)N1CC[C@H](C)[C@H](F)C1 |
| InChI | InChI=1S/C10H18FN3S/c1-7-3-4-14(6-8(7)11)9(12)5-10(13)15-2/h5,7-8,12H,3-4,6,13H2,1-2H3/b10-5+,12-9+/t7-,8+/m0/s1 |
| InChIKey | RGFARRDWZHRADO-GYWYLQEMSA-N |
| XLogP | 1.81 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|