C7H14N4 — CID 174194521
1-[(Z)-3-aminoprop-2-enimidoyl]pyrrolidin-3-amine (PubChem CID 174194521) has the molecular formula C7H14N4 and a molecular weight of 154.22 g/mol. Its IUPAC name is 1-[(Z)-3-aminoprop-2-enimidoyl]pyrrolidin-3-amine.
| Compound Name | 1-[(Z)-3-aminoprop-2-enimidoyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 174194521 |
| Molecular Formula | C7H14N4 |
| Molecular Weight | 154.22 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | 1-[(Z)-3-aminoprop-2-enimidoyl]pyrrolidin-3-amine |
| SMILES | [H]/N=C(\C=C/N)N1CCC(N)C1 |
| InChI | InChI=1S/C7H14N4/c8-3-1-7(10)11-4-2-6(9)5-11/h1,3,6,10H,2,4-5,8-9H2/b3-1-,10-7+ |
| InChIKey | JBIRODNJMHROPY-CDERUAIMSA-N |
| XLogP | -0.53 |
| TPSA | 79.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.22 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|