C13H22N4O — CID 178055981
(1Z,3Z)-2-amino-5-(4-ethynylpiperidin-1-yl)-5-iminopenta-1,3-dien-1-ol;methanamine (PubChem CID 178055981) has the molecular formula C13H22N4O and a molecular weight of 250.35 g/mol. Its IUPAC name is (1Z,3Z)-2-amino-5-(4-ethynylpiperidin-1-yl)-5-iminopenta-1,3-dien-1-ol;methanamine.
| Compound Name | (1Z,3Z)-2-amino-5-(4-ethynylpiperidin-1-yl)-5-iminopenta-1,3-dien-1-ol;methanamine |
|---|---|
| PubChem CID | 178055981 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | (1Z,3Z)-2-amino-5-(4-ethynylpiperidin-1-yl)-5-iminopenta-1,3-dien-1-ol;methanamine |
| SMILES | CN.[H]/N=C(/C=C\C(N)=C\O)N1CCC(C#C)CC1 |
| InChI | InChI=1S/C12H17N3O.CH5N/c1-2-10-5-7-15(8-6-10)12(14)4-3-11(13)9-16;1-2/h1,3-4,9-10,14,16H,5-8,13H2;2H2,1H3/b4-3-,11-9-,14-12-; |
| InChIKey | WJBOSLHXDKONJM-YKOSUZCXSA-N |
| XLogP | 0.80 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|