C20H16F6N4O5 — CID 153367301
[1-[3-[5-amino-6-(2-methyl-1,3-oxazol-5-yl)pyrazin-2-yl]-4-methylphenoxy]-3,3,3-trifluoro-2-hydroxypropyl] 2,2,2-trifluoroacetate (PubChem CID 153367301) has the molecular formula C20H16F6N4O5 and a molecular weight of 506.36 g/mol. Its IUPAC name is [1-[3-[5-amino-6-(2-methyl-1,3-oxazol-5-yl)pyrazin-2-yl]-4-methylphenoxy]-3,3,3-trifluoro-2-hydroxypropyl] 2,2,2-trifluoroacetate.
| Compound Name | [1-[3-[5-amino-6-(2-methyl-1,3-oxazol-5-yl)pyrazin-2-yl]-4-methylphenoxy]-3,3,3-trifluoro-2-hydroxypropyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 153367301 |
| Molecular Formula | C20H16F6N4O5 |
| Molecular Weight | 506.36 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | [1-[3-[5-amino-6-(2-methyl-1,3-oxazol-5-yl)pyrazin-2-yl]-4-methylphenoxy]-3,3,3-trifluoro-2-hydroxypropyl] 2,2,2-trifluoroacetate |
| SMILES | Cc1ncc(-c2nc(-c3cc(OC(OC(=O)C(F)(F)F)C(O)C(F)(F)F)ccc3C)cnc2N)o1 |
| InChI | InChI=1S/C20H16F6N4O5/c1-8-3-4-10(34-17(15(31)19(21,22)23)35-18(32)20(24,25)26)5-11(8)12-6-29-16(27)14(30-12)13-7-28-9(2)33-13/h3-7,15,17,31H,1-2H3,(H2,27,29) |
| InChIKey | ZIHZMMNKOYFVMK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 133.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|