C21H24 — CID 153369354
2-[(1Z)-buta-1,3-dienyl]-1,3,7-trimethyl-1-[(3Z)-penta-1,3-dien-2-yl]indene (PubChem CID 153369354) has the molecular formula C21H24 and a molecular weight of 276.42 g/mol. Its IUPAC name is 2-[(1Z)-buta-1,3-dienyl]-1,3,7-trimethyl-1-[(3Z)-penta-1,3-dien-2-yl]indene.
| Compound Name | 2-[(1Z)-buta-1,3-dienyl]-1,3,7-trimethyl-1-[(3Z)-penta-1,3-dien-2-yl]indene |
|---|---|
| PubChem CID | 153369354 |
| Molecular Formula | C21H24 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | 2-[(1Z)-buta-1,3-dienyl]-1,3,7-trimethyl-1-[(3Z)-penta-1,3-dien-2-yl]indene |
| SMILES | C=C/C=C\C1=C(C)c2cccc(C)c2C1(C)C(=C)/C=C\C |
| InChI | InChI=1S/C21H24/c1-7-9-14-19-17(5)18-13-10-12-15(3)20(18)21(19,6)16(4)11-8-2/h7-14H,1,4H2,2-3,5-6H3/b11-8-,14-9- |
| InChIKey | DGJLPYGSGWTFAJ-QUDGVSLASA-N |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|