C17H25NO — CID 153371003
2-methyl-N-[3-[4-(2-methylpropyl)phenyl]prop-2-ynyl]propanamide;molecular hydrogen (PubChem CID 153371003) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 2-methyl-N-[3-[4-(2-methylpropyl)phenyl]prop-2-ynyl]propanamide;molecular hydrogen.
| Compound Name | 2-methyl-N-[3-[4-(2-methylpropyl)phenyl]prop-2-ynyl]propanamide;molecular hydrogen |
|---|---|
| PubChem CID | 153371003 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 2-methyl-N-[3-[4-(2-methylpropyl)phenyl]prop-2-ynyl]propanamide;molecular hydrogen |
| SMILES | CC(C)Cc1ccc(C#CCNC(=O)C(C)C)cc1.[H][H] |
| InChI | InChI=1S/C17H23NO.H2/c1-13(2)12-16-9-7-15(8-10-16)6-5-11-18-17(19)14(3)4;/h7-10,13-14H,11-12H2,1-4H3,(H,18,19);1H |
| InChIKey | OUSFGFTZHYFHHP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|