C10H21NO4 — CID 153374045
4-(methylamino)-5-(oxolan-2-yloxy)pentane-2,3-diol (PubChem CID 153374045) has the molecular formula C10H21NO4 and a molecular weight of 219.28 g/mol. Its IUPAC name is 4-(methylamino)-5-(oxolan-2-yloxy)pentane-2,3-diol.
| Compound Name | 4-(methylamino)-5-(oxolan-2-yloxy)pentane-2,3-diol |
|---|---|
| PubChem CID | 153374045 |
| Molecular Formula | C10H21NO4 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 4-(methylamino)-5-(oxolan-2-yloxy)pentane-2,3-diol |
| SMILES | CNC(COC1CCCO1)C(O)C(C)O |
| InChI | InChI=1S/C10H21NO4/c1-7(12)10(13)8(11-2)6-15-9-4-3-5-14-9/h7-13H,3-6H2,1-2H3 |
| InChIKey | KHEAJZJXKNPAPA-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |