C24H24 — CID 153374332
1-[(3R)-3-methylpent-1-en-2-yl]-3,5-diphenylbenzene (PubChem CID 153374332) has the molecular formula C24H24 and a molecular weight of 312.46 g/mol. Its IUPAC name is 1-[(3R)-3-methylpent-1-en-2-yl]-3,5-diphenylbenzene.
| Compound Name | 1-[(3R)-3-methylpent-1-en-2-yl]-3,5-diphenylbenzene |
|---|---|
| PubChem CID | 153374332 |
| Molecular Formula | C24H24 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 1-[(3R)-3-methylpent-1-en-2-yl]-3,5-diphenylbenzene |
| SMILES | C=C(c1cc(-c2ccccc2)cc(-c2ccccc2)c1)[C@H](C)CC |
| InChI | InChI=1S/C24H24/c1-4-18(2)19(3)22-15-23(20-11-7-5-8-12-20)17-24(16-22)21-13-9-6-10-14-21/h5-18H,3-4H2,1-2H3/t18-/m1/s1 |
| InChIKey | WRMJXJLSFMKUND-GOSISDBHSA-N |
| XLogP | 7.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |