About 1-[(3R)-3-methylpent-1-en-2-yl]-3,5-diphenylbenzene
1-[(3R)-3-methylpent-1-en-2-yl]-3,5-diphenylbenzene (PubChem CID 153374332) has the molecular formula C24H24
and a molecular weight of 312.46 g/mol. Its IUPAC name is 1-[(3R)-3-methylpent-1-en-2-yl]-3,5-diphenylbenzene.
Molecular Properties
| Compound Name | 1-[(3R)-3-methylpent-1-en-2-yl]-3,5-diphenylbenzene |
| PubChem CID | 153374332 |
| Molecular Formula | C24H24 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 1-[(3R)-3-methylpent-1-en-2-yl]-3,5-diphenylbenzene |
| SMILES | C=C(c1cc(-c2ccccc2)cc(-c2ccccc2)c1)[C@H](C)CC |
| InChI | InChI=1S/C24H24/c1-4-18(2)19(3)22-15-23(20-11-7-5-8-12-20)17-24(16-22)21-13-9-6-10-14-21/h5-18H,3-4H2,1-2H3/t18-/m1/s1 |
| InChIKey | WRMJXJLSFMKUND-GOSISDBHSA-N |
| XLogP | 7.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-[(3R)-3-methylpent-1-en-2-yl]-3,5-diphenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3R)-3-methylpent-1-en-2-yl]-3,5-diphenylbenzene?
The IUPAC name of 1-[(3R)-3-methylpent-1-en-2-yl]-3,5-diphenylbenzene (CID 153374332) is 1-[(3R)-3-methylpent-1-en-2-yl]-3,5-diphenylbenzene.
What is the SMILES notation for 1-[(3R)-3-methylpent-1-en-2-yl]-3,5-diphenylbenzene?
The canonical SMILES for 1-[(3R)-3-methylpent-1-en-2-yl]-3,5-diphenylbenzene is C=C(c1cc(-c2ccccc2)cc(-c2ccccc2)c1)[C@H](C)CC.
What is the InChIKey of 1-[(3R)-3-methylpent-1-en-2-yl]-3,5-diphenylbenzene?
The InChIKey is WRMJXJLSFMKUND-GOSISDBHSA-N. The full InChI is InChI=1S/C24H24/c1-4-18(2)19(3)22-15-23(20-11-7-5-8-12-20)17-24(16-22)21-13-9-6-10-14-21/h5-18H,3-4H2,1-2H3/t18-/m1/s1.
What are the key properties of 1-[(3R)-3-methylpent-1-en-2-yl]-3,5-diphenylbenzene?
1-[(3R)-3-methylpent-1-en-2-yl]-3,5-diphenylbenzene has a molecular weight of 312.46 g/mol, XLogP of 7.08, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3R)-3-methylpent-1-en-2-yl]-3,5-diphenylbenzene is sourced from PubChem (CID 153374332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).