C15H10F5N3O2 — CID 153376136
(2,3,4,5,6-pentafluorophenyl) 3-(2-amino-1-hydrazinylethenyl)benzoate (PubChem CID 153376136) has the molecular formula C15H10F5N3O2 and a molecular weight of 359.25 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 3-(2-amino-1-hydrazinylethenyl)benzoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 3-(2-amino-1-hydrazinylethenyl)benzoate |
|---|---|
| PubChem CID | 153376136 |
| Molecular Formula | C15H10F5N3O2 |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 3-(2-amino-1-hydrazinylethenyl)benzoate |
| SMILES | NC=C(NN)c1cccc(C(=O)Oc2c(F)c(F)c(F)c(F)c2F)c1 |
| InChI | InChI=1S/C15H10F5N3O2/c16-9-10(17)12(19)14(13(20)11(9)18)25-15(24)7-3-1-2-6(4-7)8(5-21)23-22/h1-5,23H,21-22H2 |
| InChIKey | DUSITPSTKPQEHC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|