C14H21IN4 — CID 153376836
1-[2,6-dimethyl-4-(1-methylpyrazol-4-yl)phenyl]-1-iodohydrazine;ethane (PubChem CID 153376836) has the molecular formula C14H21IN4 and a molecular weight of 372.25 g/mol. Its IUPAC name is 1-[2,6-dimethyl-4-(1-methylpyrazol-4-yl)phenyl]-1-iodohydrazine;ethane.
| Compound Name | 1-[2,6-dimethyl-4-(1-methylpyrazol-4-yl)phenyl]-1-iodohydrazine;ethane |
|---|---|
| PubChem CID | 153376836 |
| Molecular Formula | C14H21IN4 |
| Molecular Weight | 372.25 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 1-[2,6-dimethyl-4-(1-methylpyrazol-4-yl)phenyl]-1-iodohydrazine;ethane |
| SMILES | CC.Cc1cc(-c2cnn(C)c2)cc(C)c1N(N)I |
| InChI | InChI=1S/C12H15IN4.C2H6/c1-8-4-10(11-6-15-16(3)7-11)5-9(2)12(8)17(13)14;1-2/h4-7H,14H2,1-3H3;1-2H3 |
| InChIKey | CHCUSYMKUXAEQB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.25 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|