C20H29N5O2 — CID 165124623
tert-butyl 4-[4-amino-5-methyl-2-(1-methylpyrazol-4-yl)phenyl]piperazine-1-carboxylate (PubChem CID 165124623) has the molecular formula C20H29N5O2 and a molecular weight of 371.49 g/mol. Its IUPAC name is tert-butyl 4-[4-amino-5-methyl-2-(1-methylpyrazol-4-yl)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-amino-5-methyl-2-(1-methylpyrazol-4-yl)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 165124623 |
| Molecular Formula | C20H29N5O2 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | tert-butyl 4-[4-amino-5-methyl-2-(1-methylpyrazol-4-yl)phenyl]piperazine-1-carboxylate |
| SMILES | Cc1cc(N2CCN(C(=O)OC(C)(C)C)CC2)c(-c2cnn(C)c2)cc1N |
| InChI | InChI=1S/C20H29N5O2/c1-14-10-18(16(11-17(14)21)15-12-22-23(5)13-15)24-6-8-25(9-7-24)19(26)27-20(2,3)4/h10-13H,6-9,21H2,1-5H3 |
| InChIKey | FXABLRKXMYPVFO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 76.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|