C19H28FN3 — CID 153377682
(Z)-2-[1-[(3-fluoro-2-methylcyclobuten-1-yl)methyl]-4-methyl-3,6-dihydro-2H-pyridin-5-yl]-3-(methylamino)hex-2-enenitrile (PubChem CID 153377682) has the molecular formula C19H28FN3 and a molecular weight of 317.45 g/mol. Its IUPAC name is (Z)-2-[1-[(3-fluoro-2-methylcyclobuten-1-yl)methyl]-4-methyl-3,6-dihydro-2H-pyridin-5-yl]-3-(methylamino)hex-2-enenitrile.
| Compound Name | (Z)-2-[1-[(3-fluoro-2-methylcyclobuten-1-yl)methyl]-4-methyl-3,6-dihydro-2H-pyridin-5-yl]-3-(methylamino)hex-2-enenitrile |
|---|---|
| PubChem CID | 153377682 |
| Molecular Formula | C19H28FN3 |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.23 |
| IUPAC Name | (Z)-2-[1-[(3-fluoro-2-methylcyclobuten-1-yl)methyl]-4-methyl-3,6-dihydro-2H-pyridin-5-yl]-3-(methylamino)hex-2-enenitrile |
| SMILES | CCC/C(NC)=C(/C#N)C1=C(C)CCN(CC2=C(C)C(F)C2)C1 |
| InChI | InChI=1S/C19H28FN3/c1-5-6-19(22-4)16(10-21)17-12-23(8-7-13(17)2)11-15-9-18(20)14(15)3/h18,22H,5-9,11-12H2,1-4H3/b19-16+ |
| InChIKey | ABFAZYBGEDBDEB-KNTRCKAVSA-N |
| XLogP | 3.86 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|