About CID 153379110
CID 153379110 (PubChem CID 153379110) has the molecular formula C15H25BO2
and a molecular weight of 248.17 g/mol.
Molecular Properties
| Compound Name | CID 153379110 |
| PubChem CID | 153379110 |
| Molecular Formula | C15H25BO2 |
| Molecular Weight | 248.17 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | — |
| SMILES | CC.[B]CCOCCOc1ccc(CCC)cc1 |
| InChI | InChI=1S/C13H19BO2.C2H6/c1-2-3-12-4-6-13(7-5-12)16-11-10-15-9-8-14;1-2/h4-7H,2-3,8-11H2,1H3;1-2H3 |
| InChIKey | PCGYBMMSCQHORI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.17 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 153379110 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153379110?
The IUPAC name of CID 153379110 (CID 153379110) is not available.
What is the SMILES notation for CID 153379110?
The canonical SMILES for CID 153379110 is CC.[B]CCOCCOc1ccc(CCC)cc1.
What is the InChIKey of CID 153379110?
The InChIKey is PCGYBMMSCQHORI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19BO2.C2H6/c1-2-3-12-4-6-13(7-5-12)16-11-10-15-9-8-14;1-2/h4-7H,2-3,8-11H2,1H3;1-2H3.
What are the key properties of CID 153379110?
CID 153379110 has a molecular weight of 248.17 g/mol, XLogP of 3.65, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153379110 is sourced from PubChem (CID 153379110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).